C20H17FN4O6 — CID 55753214
methyl 3-[2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethoxy]-4-nitrobenzoate (PubChem CID 55753214) has the molecular formula C20H17FN4O6 and a molecular weight of 428.38 g/mol. Its IUPAC name is methyl 3-[2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethoxy]-4-nitrobenzoate.
| Compound Name | methyl 3-[2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethoxy]-4-nitrobenzoate |
|---|---|
| PubChem CID | 55753214 |
| Molecular Formula | C20H17FN4O6 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | methyl 3-[2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethoxy]-4-nitrobenzoate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(OCC(=O)Nc2cc(C)nn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H17FN4O6/c1-12-9-18(24(23-12)15-6-4-14(21)5-7-15)22-19(26)11-31-17-10-13(20(27)30-2)3-8-16(17)25(28)29/h3-10H,11H2,1-2H3,(H,22,26) |
| InChIKey | XIMNYFVPJUTPLP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|