C22H18FN3O2 — CID 35534820
N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]-2-naphthalen-2-yloxyacetamide (PubChem CID 35534820) has the molecular formula C22H18FN3O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 35534820 |
| Molecular Formula | C22H18FN3O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]-2-naphthalen-2-yloxyacetamide |
| SMILES | Cc1cc(NC(=O)COc2ccc3ccccc3c2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H18FN3O2/c1-15-12-21(26(25-15)19-9-7-18(23)8-10-19)24-22(27)14-28-20-11-6-16-4-2-3-5-17(16)13-20/h2-13H,14H2,1H3,(H,24,27) |
| InChIKey | ASNBTJWDJNOYBZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |