C21H20FN3O4 — CID 24570195
[2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 3-phenoxypropanoate (PubChem CID 24570195) has the molecular formula C21H20FN3O4 and a molecular weight of 397.41 g/mol. Its IUPAC name is [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 3-phenoxypropanoate.
| Compound Name | [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 3-phenoxypropanoate |
|---|---|
| PubChem CID | 24570195 |
| Molecular Formula | C21H20FN3O4 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 3-phenoxypropanoate |
| SMILES | Cc1cc(NC(=O)COC(=O)CCOc2ccccc2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H20FN3O4/c1-15-13-19(25(24-15)17-9-7-16(22)8-10-17)23-20(26)14-29-21(27)11-12-28-18-5-3-2-4-6-18/h2-10,13H,11-12,14H2,1H3,(H,23,26) |
| InChIKey | QNVLZOQJRRJMBB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |