C21H17FN4O3 — CID 24572043
[2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 24572043) has the molecular formula C21H17FN4O3 and a molecular weight of 392.39 g/mol. Its IUPAC name is [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 24572043 |
| Molecular Formula | C21H17FN4O3 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2c[nH]c3ccccc23)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H17FN4O3/c1-13-10-19(26(25-13)15-8-6-14(22)7-9-15)24-20(27)12-29-21(28)17-11-23-18-5-3-2-4-16(17)18/h2-11,23H,12H2,1H3,(H,24,27) |
| InChIKey | MBLZTLMJWHWJOV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |