C19H16FN3O4 — CID 24569367
[2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 24569367) has the molecular formula C19H16FN3O4 and a molecular weight of 369.35 g/mol. Its IUPAC name is [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 24569367 |
| Molecular Formula | C19H16FN3O4 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2cccc(O)c2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H16FN3O4/c1-12-9-17(23(22-12)15-7-5-14(20)6-8-15)21-18(25)11-27-19(26)13-3-2-4-16(24)10-13/h2-10,24H,11H2,1H3,(H,21,25) |
| InChIKey | UHFYURVZFAHPON-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |