C20H18FN5O5 — CID 24569037
[2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate (PubChem CID 24569037) has the molecular formula C20H18FN5O5 and a molecular weight of 427.39 g/mol. Its IUPAC name is [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 24569037 |
| Molecular Formula | C20H18FN5O5 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [2-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]amino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)OCC(=O)Nc2cc(C)nn2-c2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18FN5O5/c1-12-9-18(25(24-12)15-6-4-14(21)5-7-15)23-19(27)11-31-20(28)13-3-8-16(22-2)17(10-13)26(29)30/h3-10,22H,11H2,1-2H3,(H,23,27) |
| InChIKey | XNKQOLJHBSENID-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|