C19H19N5O6S — CID 55528814
N-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]-2-(2-nitro-4-sulfamoylphenoxy)acetamide (PubChem CID 55528814) has the molecular formula C19H19N5O6S and a molecular weight of 445.46 g/mol. Its IUPAC name is N-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]-2-(2-nitro-4-sulfamoylphenoxy)acetamide.
| Compound Name | N-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]-2-(2-nitro-4-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 55528814 |
| Molecular Formula | C19H19N5O6S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-[5-methyl-2-(4-methylphenyl)pyrazol-3-yl]-2-(2-nitro-4-sulfamoylphenoxy)acetamide |
| SMILES | Cc1ccc(-n2nc(C)cc2NC(=O)COc2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N5O6S/c1-12-3-5-14(6-4-12)23-18(9-13(2)22-23)21-19(25)11-30-17-8-7-15(31(20,28)29)10-16(17)24(26)27/h3-10H,11H2,1-2H3,(H,21,25)(H2,20,28,29) |
| InChIKey | XXDNEBCWXPUUBD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|