C14H12IN3O6S — CID 55528382
N-(3-iodophenyl)-2-(2-nitro-4-sulfamoylphenoxy)acetamide (PubChem CID 55528382) has the molecular formula C14H12IN3O6S and a molecular weight of 477.24 g/mol. Its IUPAC name is N-(3-iodophenyl)-2-(2-nitro-4-sulfamoylphenoxy)acetamide.
| Compound Name | N-(3-iodophenyl)-2-(2-nitro-4-sulfamoylphenoxy)acetamide |
|---|---|
| PubChem CID | 55528382 |
| Molecular Formula | C14H12IN3O6S |
| Molecular Weight | 477.24 g/mol |
| Exact Mass | 476.95 |
| IUPAC Name | N-(3-iodophenyl)-2-(2-nitro-4-sulfamoylphenoxy)acetamide |
| SMILES | NS(=O)(=O)c1ccc(OCC(=O)Nc2cccc(I)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12IN3O6S/c15-9-2-1-3-10(6-9)17-14(19)8-24-13-5-4-11(25(16,22)23)7-12(13)18(20)21/h1-7H,8H2,(H,17,19)(H2,16,22,23) |
| InChIKey | HPIJDQWNWGSJLG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|