C17H21N5O7S — CID 24567269
N-(2,5-dimethylpyrazol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)acetamide (PubChem CID 24567269) has the molecular formula C17H21N5O7S and a molecular weight of 439.45 g/mol. Its IUPAC name is N-(2,5-dimethylpyrazol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)acetamide.
| Compound Name | N-(2,5-dimethylpyrazol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 24567269 |
| Molecular Formula | C17H21N5O7S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-(2,5-dimethylpyrazol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)acetamide |
| SMILES | Cc1cc(NC(=O)COc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])n(C)n1 |
| InChI | InChI=1S/C17H21N5O7S/c1-12-9-16(20(2)19-12)18-17(23)11-29-15-4-3-13(10-14(15)22(24)25)30(26,27)21-5-7-28-8-6-21/h3-4,9-10H,5-8,11H2,1-2H3,(H,18,23) |
| InChIKey | OUJPNMVAFUJOFR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|