C18H17Cl2N3O6S — CID 4213935
N-(2,3-dichlorophenyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide (PubChem CID 4213935) has the molecular formula C18H17Cl2N3O6S and a molecular weight of 474.32 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 4213935 |
| Molecular Formula | C18H17Cl2N3O6S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-(2-nitro-4-pyrrolidin-1-ylsulfonylphenoxy)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCCC2)cc1[N+](=O)[O-])Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H17Cl2N3O6S/c19-13-4-3-5-14(18(13)20)21-17(24)11-29-16-7-6-12(10-15(16)23(25)26)30(27,28)22-8-1-2-9-22/h3-7,10H,1-2,8-9,11H2,(H,21,24) |
| InChIKey | SHBJEJBDFFAUKC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|