C12H14N2O8S — CID 16771112
2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)acetic acid (PubChem CID 16771112) has the molecular formula C12H14N2O8S and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)acetic acid.
| Compound Name | 2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)acetic acid |
|---|---|
| PubChem CID | 16771112 |
| Molecular Formula | C12H14N2O8S |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-(4-morpholin-4-ylsulfonyl-2-nitrophenoxy)acetic acid |
| SMILES | O=C(O)COc1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N2O8S/c15-12(16)8-22-11-2-1-9(7-10(11)14(17)18)23(19,20)13-3-5-21-6-4-13/h1-2,7H,3-6,8H2,(H,15,16) |
| InChIKey | DHNJEFUXSHGETE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|