C14H19N3O7S — CID 122059581
3-(N-methyl-4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoic acid (PubChem CID 122059581) has the molecular formula C14H19N3O7S and a molecular weight of 373.39 g/mol. Its IUPAC name is 3-(N-methyl-4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoic acid.
| Compound Name | 3-(N-methyl-4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoic acid |
|---|---|
| PubChem CID | 122059581 |
| Molecular Formula | C14H19N3O7S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 3-(N-methyl-4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoic acid |
| SMILES | CN(CCC(=O)O)c1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O7S/c1-15(5-4-14(18)19)12-3-2-11(10-13(12)17(20)21)25(22,23)16-6-8-24-9-7-16/h2-3,10H,4-9H2,1H3,(H,18,19) |
| InChIKey | KMSGBZQFOBHWNW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|