C16H25N3O5S — CID 26472283
N-butyl-N-ethyl-4-morpholin-4-ylsulfonyl-2-nitroaniline (PubChem CID 26472283) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-butyl-N-ethyl-4-morpholin-4-ylsulfonyl-2-nitroaniline.
| Compound Name | N-butyl-N-ethyl-4-morpholin-4-ylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 26472283 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-butyl-N-ethyl-4-morpholin-4-ylsulfonyl-2-nitroaniline |
| SMILES | CCCCN(CC)c1ccc(S(=O)(=O)N2CCOCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N3O5S/c1-3-5-8-17(4-2)15-7-6-14(13-16(15)19(20)21)25(22,23)18-9-11-24-12-10-18/h6-7,13H,3-5,8-12H2,1-2H3 |
| InChIKey | NZUUHKMLCKUVEB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|