C20H20N6O6 — CID 55753266
methyl 3-[2-[[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]amino]-2-oxoethoxy]-4-nitrobenzoate (PubChem CID 55753266) has the molecular formula C20H20N6O6 and a molecular weight of 440.42 g/mol. Its IUPAC name is methyl 3-[2-[[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]amino]-2-oxoethoxy]-4-nitrobenzoate.
| Compound Name | methyl 3-[2-[[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]amino]-2-oxoethoxy]-4-nitrobenzoate |
|---|---|
| PubChem CID | 55753266 |
| Molecular Formula | C20H20N6O6 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | methyl 3-[2-[[2-(4,6-dimethylpyrimidin-2-yl)-5-methylpyrazol-3-yl]amino]-2-oxoethoxy]-4-nitrobenzoate |
| SMILES | COC(=O)c1ccc([N+](=O)[O-])c(OCC(=O)Nc2cc(C)nn2-c2nc(C)cc(C)n2)c1 |
| InChI | InChI=1S/C20H20N6O6/c1-11-7-12(2)22-20(21-11)25-17(8-13(3)24-25)23-18(27)10-32-16-9-14(19(28)31-4)5-6-15(16)26(29)30/h5-9H,10H2,1-4H3,(H,23,27) |
| InChIKey | OIBZRRSZKNHWSX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|