C15H8F3N5O3 — CID 17405243
3-nitro-4-(1,2,4-triazol-1-yl)-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 17405243) has the molecular formula C15H8F3N5O3 and a molecular weight of 363.26 g/mol. Its IUPAC name is 3-nitro-4-(1,2,4-triazol-1-yl)-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 3-nitro-4-(1,2,4-triazol-1-yl)-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 17405243 |
| Molecular Formula | C15H8F3N5O3 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 3-nitro-4-(1,2,4-triazol-1-yl)-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H8F3N5O3/c16-9-2-3-10(14(18)13(9)17)21-15(24)8-1-4-11(12(5-8)23(25)26)22-7-19-6-20-22/h1-7H,(H,21,24) |
| InChIKey | PRFDATGGIRIZDX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|