C16H10F3N5O3 — CID 56518476
4-imidazol-1-yl-3-nitro-N'-(2,3,4-trifluorophenyl)benzohydrazide (PubChem CID 56518476) has the molecular formula C16H10F3N5O3 and a molecular weight of 377.28 g/mol. Its IUPAC name is 4-imidazol-1-yl-3-nitro-N'-(2,3,4-trifluorophenyl)benzohydrazide.
| Compound Name | 4-imidazol-1-yl-3-nitro-N'-(2,3,4-trifluorophenyl)benzohydrazide |
|---|---|
| PubChem CID | 56518476 |
| Molecular Formula | C16H10F3N5O3 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-imidazol-1-yl-3-nitro-N'-(2,3,4-trifluorophenyl)benzohydrazide |
| SMILES | O=C(NNc1ccc(F)c(F)c1F)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10F3N5O3/c17-10-2-3-11(15(19)14(10)18)21-22-16(25)9-1-4-12(13(7-9)24(26)27)23-6-5-20-8-23/h1-8,21H,(H,22,25) |
| InChIKey | JDQATPPMEWOQBW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|