C18H16FN5O3 — CID 47983181
4-[(3-fluoro-4-imidazol-1-ylphenyl)methylamino]-N-methyl-3-nitrobenzamide (PubChem CID 47983181) has the molecular formula C18H16FN5O3 and a molecular weight of 369.36 g/mol. Its IUPAC name is 4-[(3-fluoro-4-imidazol-1-ylphenyl)methylamino]-N-methyl-3-nitrobenzamide.
| Compound Name | 4-[(3-fluoro-4-imidazol-1-ylphenyl)methylamino]-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 47983181 |
| Molecular Formula | C18H16FN5O3 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 4-[(3-fluoro-4-imidazol-1-ylphenyl)methylamino]-N-methyl-3-nitrobenzamide |
| SMILES | CNC(=O)c1ccc(NCc2ccc(-n3ccnc3)c(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16FN5O3/c1-20-18(25)13-3-4-15(17(9-13)24(26)27)22-10-12-2-5-16(14(19)8-12)23-7-6-21-11-23/h2-9,11,22H,10H2,1H3,(H,20,25) |
| InChIKey | QWRNCKFIBHSFAH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|