C19H17N5O4 — CID 46454270
3-[(4-imidazol-1-yl-3-nitrobenzoyl)amino]-N,2-dimethylbenzamide (PubChem CID 46454270) has the molecular formula C19H17N5O4 and a molecular weight of 379.38 g/mol. Its IUPAC name is 3-[(4-imidazol-1-yl-3-nitrobenzoyl)amino]-N,2-dimethylbenzamide.
| Compound Name | 3-[(4-imidazol-1-yl-3-nitrobenzoyl)amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 46454270 |
| Molecular Formula | C19H17N5O4 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-[(4-imidazol-1-yl-3-nitrobenzoyl)amino]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2ccc(-n3ccnc3)c([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C19H17N5O4/c1-12-14(19(26)20-2)4-3-5-15(12)22-18(25)13-6-7-16(17(10-13)24(27)28)23-9-8-21-11-23/h3-11H,1-2H3,(H,20,26)(H,22,25) |
| InChIKey | CPCBPFNEBOAQDX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|