C20H18ClN5O4 — CID 52699656
N-[5-chloro-2-(propylcarbamoyl)phenyl]-4-imidazol-1-yl-3-nitrobenzamide (PubChem CID 52699656) has the molecular formula C20H18ClN5O4 and a molecular weight of 427.85 g/mol. Its IUPAC name is N-[5-chloro-2-(propylcarbamoyl)phenyl]-4-imidazol-1-yl-3-nitrobenzamide.
| Compound Name | N-[5-chloro-2-(propylcarbamoyl)phenyl]-4-imidazol-1-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 52699656 |
| Molecular Formula | C20H18ClN5O4 |
| Molecular Weight | 427.85 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-[5-chloro-2-(propylcarbamoyl)phenyl]-4-imidazol-1-yl-3-nitrobenzamide |
| SMILES | CCCNC(=O)c1ccc(Cl)cc1NC(=O)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18ClN5O4/c1-2-7-23-20(28)15-5-4-14(21)11-16(15)24-19(27)13-3-6-17(18(10-13)26(29)30)25-9-8-22-12-25/h3-6,8-12H,2,7H2,1H3,(H,23,28)(H,24,27) |
| InChIKey | UZPUJPVZLUMNHQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|