C18H19N5O3S — CID 52707198
N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)-4-imidazol-1-yl-3-nitrobenzamide (PubChem CID 52707198) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)-4-imidazol-1-yl-3-nitrobenzamide.
| Compound Name | N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)-4-imidazol-1-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 52707198 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-(5-ethyl-4-propyl-1,3-thiazol-2-yl)-4-imidazol-1-yl-3-nitrobenzamide |
| SMILES | CCCc1nc(NC(=O)c2ccc(-n3ccnc3)c([N+](=O)[O-])c2)sc1CC |
| InChI | InChI=1S/C18H19N5O3S/c1-3-5-13-16(4-2)27-18(20-13)21-17(24)12-6-7-14(15(10-12)23(25)26)22-9-8-19-11-22/h6-11H,3-5H2,1-2H3,(H,20,21,24) |
| InChIKey | NSQRARIYYOPRJH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|