C18H18N6O4S — CID 112761952
4-imidazol-1-yl-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 112761952) has the molecular formula C18H18N6O4S and a molecular weight of 414.45 g/mol. Its IUPAC name is 4-imidazol-1-yl-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | 4-imidazol-1-yl-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 112761952 |
| Molecular Formula | C18H18N6O4S |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4-imidazol-1-yl-N-[4-(morpholin-4-ylmethyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | O=C(Nc1nc(CN2CCOCC2)cs1)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N6O4S/c25-17(21-18-20-14(11-29-18)10-22-5-7-28-8-6-22)13-1-2-15(16(9-13)24(26)27)23-4-3-19-12-23/h1-4,9,11-12H,5-8,10H2,(H,20,21,25) |
| InChIKey | NAXQYOKVTNVJSO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|