C19H12ClN5O3S — CID 112760807
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-imidazol-1-yl-3-nitrobenzamide (PubChem CID 112760807) has the molecular formula C19H12ClN5O3S and a molecular weight of 425.86 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-imidazol-1-yl-3-nitrobenzamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-imidazol-1-yl-3-nitrobenzamide |
|---|---|
| PubChem CID | 112760807 |
| Molecular Formula | C19H12ClN5O3S |
| Molecular Weight | 425.86 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-4-imidazol-1-yl-3-nitrobenzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2Cl)cs1)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12ClN5O3S/c20-14-4-2-1-3-13(14)15-10-29-19(22-15)23-18(26)12-5-6-16(17(9-12)25(27)28)24-8-7-21-11-24/h1-11H,(H,22,23,26) |
| InChIKey | KTUIYBMBRCOMCP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.86 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|