C13H12N4O5 — CID 78765885
[2-(methylamino)-2-oxoethyl] 4-imidazol-1-yl-3-nitrobenzoate (PubChem CID 78765885) has the molecular formula C13H12N4O5 and a molecular weight of 304.26 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-imidazol-1-yl-3-nitrobenzoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-imidazol-1-yl-3-nitrobenzoate |
|---|---|
| PubChem CID | 78765885 |
| Molecular Formula | C13H12N4O5 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-imidazol-1-yl-3-nitrobenzoate |
| SMILES | CNC(=O)COC(=O)c1ccc(-n2ccnc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N4O5/c1-14-12(18)7-22-13(19)9-2-3-10(11(6-9)17(20)21)16-5-4-15-8-16/h2-6,8H,7H2,1H3,(H,14,18) |
| InChIKey | ZFZYJUOIEJXDSX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|