C17H14FN5O3 — CID 9490552
N-[2-(2-fluorophenyl)ethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 9490552) has the molecular formula C17H14FN5O3 and a molecular weight of 355.33 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 9490552 |
| Molecular Formula | C17H14FN5O3 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(NCCc1ccccc1F)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H14FN5O3/c18-14-4-2-1-3-12(14)7-8-20-17(24)13-5-6-15(16(9-13)23(25)26)22-11-19-10-21-22/h1-6,9-11H,7-8H2,(H,20,24) |
| InChIKey | SNZZKKDOPQCWCE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|