C21H24N6O3 — CID 26975988
N-[[2-(diethylaminomethyl)phenyl]methyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 26975988) has the molecular formula C21H24N6O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[[2-(diethylaminomethyl)phenyl]methyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 26975988 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCN(CC)CC1=CC=CC=C1CNC(=O)C2=CC(=C(C=C2)N3C=NC=N3)[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N6O3/c1-3-25(4-2)13-18-8-6-5-7-17(18)12-23-21(28)16-9-10-19(20(11-16)27(29)30)26-15-22-14-24-26/h5-11,14-15H,3-4,12-13H2,1-2H3,(H,23,28) |
| InChIKey | AGYXCGUEPGIWGZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | 567 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|