C19H19N5O3 — CID 51192381
N-benzyl-3-nitro-N-propyl-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 51192381) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-benzyl-3-nitro-N-propyl-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-benzyl-3-nitro-N-propyl-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 51192381 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-benzyl-3-nitro-N-propyl-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCCN(Cc1ccccc1)C(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N5O3/c1-2-10-22(12-15-6-4-3-5-7-15)19(25)16-8-9-17(18(11-16)24(26)27)23-14-20-13-21-23/h3-9,11,13-14H,2,10,12H2,1H3 |
| InChIKey | UBNMRWSAMKYTTP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|