C23H21N5O3S — CID 46538315
N-[(5-methylthiophen-2-yl)methyl]-3-nitro-N-(2-phenylethyl)-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 46538315) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-3-nitro-N-(2-phenylethyl)-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-3-nitro-N-(2-phenylethyl)-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46538315 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-3-nitro-N-(2-phenylethyl)-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1ccc(CN(CCc2ccccc2)C(=O)c2ccc(-n3cncn3)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C23H21N5O3S/c1-17-7-9-20(32-17)14-26(12-11-18-5-3-2-4-6-18)23(29)19-8-10-21(22(13-19)28(30)31)27-16-24-15-25-27/h2-10,13,15-16H,11-12,14H2,1H3 |
| InChIKey | QSIFZXXXWZWAIV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|