C22H22N2O3S2 — CID 18206826
4-methylsulfanyl-N-[(5-methylthiophen-2-yl)methyl]-3-nitro-N-(2-phenylethyl)benzamide (PubChem CID 18206826) has the molecular formula C22H22N2O3S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 4-methylsulfanyl-N-[(5-methylthiophen-2-yl)methyl]-3-nitro-N-(2-phenylethyl)benzamide.
| Compound Name | 4-methylsulfanyl-N-[(5-methylthiophen-2-yl)methyl]-3-nitro-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 18206826 |
| Molecular Formula | C22H22N2O3S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-methylsulfanyl-N-[(5-methylthiophen-2-yl)methyl]-3-nitro-N-(2-phenylethyl)benzamide |
| SMILES | CSc1ccc(C(=O)N(CCc2ccccc2)Cc2ccc(C)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H22N2O3S2/c1-16-8-10-19(29-16)15-23(13-12-17-6-4-3-5-7-17)22(25)18-9-11-21(28-2)20(14-18)24(26)27/h3-11,14H,12-13,15H2,1-2H3 |
| InChIKey | HRNPMEKMPBWZDG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|