C26H27N3O4S — CID 4573457
N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-prop-2-enylbenzamide (PubChem CID 4573457) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-prop-2-enylbenzamide.
| Compound Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4573457 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-4-methyl-3-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1)C(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H27N3O4S/c1-4-14-27(26(31)22-12-10-19(2)24(15-22)29(32)33)18-25(30)28(16-21-8-6-5-7-9-21)17-23-13-11-20(3)34-23/h4-13,15H,1,14,16-18H2,2-3H3 |
| InChIKey | DQZKBLLBHOTTGV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|