C26H28N2O2S2 — CID 3972513
N-benzyl-N-[(5-methylthiophen-2-yl)methyl]-2-[(2-phenylsulfanylacetyl)-prop-2-enylamino]acetamide (PubChem CID 3972513) has the molecular formula C26H28N2O2S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is N-benzyl-N-[(5-methylthiophen-2-yl)methyl]-2-[(2-phenylsulfanylacetyl)-prop-2-enylamino]acetamide.
| Compound Name | N-benzyl-N-[(5-methylthiophen-2-yl)methyl]-2-[(2-phenylsulfanylacetyl)-prop-2-enylamino]acetamide |
|---|---|
| PubChem CID | 3972513 |
| Molecular Formula | C26H28N2O2S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-benzyl-N-[(5-methylthiophen-2-yl)methyl]-2-[(2-phenylsulfanylacetyl)-prop-2-enylamino]acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1)C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C26H28N2O2S2/c1-3-16-27(26(30)20-31-23-12-8-5-9-13-23)19-25(29)28(17-22-10-6-4-7-11-22)18-24-15-14-21(2)32-24/h3-15H,1,16-20H2,2H3 |
| InChIKey | TVWQQXCJMAYURS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|