C21H25ClN2O2S — CID 5145547
N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-chloro-N-prop-2-enylpropanamide (PubChem CID 5145547) has the molecular formula C21H25ClN2O2S and a molecular weight of 404.96 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-chloro-N-prop-2-enylpropanamide.
| Compound Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-chloro-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 5145547 |
| Molecular Formula | C21H25ClN2O2S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[2-[benzyl-[(5-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-chloro-N-prop-2-enylpropanamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)s1)C(=O)CCCl |
| InChI | InChI=1S/C21H25ClN2O2S/c1-3-13-23(20(25)11-12-22)16-21(26)24(14-18-7-5-4-6-8-18)15-19-10-9-17(2)27-19/h3-10H,1,11-16H2,2H3 |
| InChIKey | UIJOAMKQNMGMNW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|