C15H16F3N5O3 — CID 55763594
N-butyl-3-nitro-4-(1,2,4-triazol-1-yl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 55763594) has the molecular formula C15H16F3N5O3 and a molecular weight of 371.32 g/mol. Its IUPAC name is N-butyl-3-nitro-4-(1,2,4-triazol-1-yl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | N-butyl-3-nitro-4-(1,2,4-triazol-1-yl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 55763594 |
| Molecular Formula | C15H16F3N5O3 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-butyl-3-nitro-4-(1,2,4-triazol-1-yl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CCCCN(CC(F)(F)F)C(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16F3N5O3/c1-2-3-6-21(8-15(16,17)18)14(24)11-4-5-12(13(7-11)23(25)26)22-10-19-9-20-22/h4-5,7,9-10H,2-3,6,8H2,1H3 |
| InChIKey | CDPKTOARCAHEBE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|