C17H13F2N5O3 — CID 51192472
N-[1-(2,4-difluorophenyl)ethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 51192472) has the molecular formula C17H13F2N5O3 and a molecular weight of 373.32 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 51192472 |
| Molecular Formula | C17H13F2N5O3 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-3-nitro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CC(NC(=O)c1ccc(-n2cncn2)c([N+](=O)[O-])c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H13F2N5O3/c1-10(13-4-3-12(18)7-14(13)19)22-17(25)11-2-5-15(16(6-11)24(26)27)23-9-20-8-21-23/h2-10H,1H3,(H,22,25) |
| InChIKey | SQOVGRCYCJBMPW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|