C14H11F3N2O4 — CID 51150524
5-nitro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]furan-2-carboxamide (PubChem CID 51150524) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is 5-nitro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]furan-2-carboxamide.
| Compound Name | 5-nitro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51150524 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 5-nitro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc([N+](=O)[O-])o1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F3N2O4/c1-8(9-3-2-4-10(7-9)14(15,16)17)18-13(20)11-5-6-12(23-11)19(21)22/h2-8H,1H3,(H,18,20) |
| InChIKey | JCNLZJINRSGPJH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|