C13H11NO5 — CID 3683974
[2-(methylamino)-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 3683974) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 3683974 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | CNC(=O)COC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C13H11NO5/c1-14-11(15)7-18-12(16)9-6-8-4-2-3-5-10(8)19-13(9)17/h2-6H,7H2,1H3,(H,14,15) |
| InChIKey | RHEKDTZGFWXOKD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|