C19H21NO5 — CID 7785508
[2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 7785508) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 7785508 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)COC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H21NO5/c1-12-6-2-4-8-15(12)20-17(21)11-24-18(22)14-10-13-7-3-5-9-16(13)25-19(14)23/h3,5,7,9-10,12,15H,2,4,6,8,11H2,1H3,(H,20,21)/t12-,15-/m0/s1 |
| InChIKey | HTKHUMSVEUAYGX-WFASDCNBSA-N |
| XLogP | 2.64 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|