C18H20N2O6 — CID 9290349
[2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 2-oxochromene-3-carboxylate (PubChem CID 9290349) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 9290349 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [2-oxo-2-[[(2R)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 2-oxochromene-3-carboxylate |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)COC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C18H20N2O6/c1-3-8-19-16(22)11(2)20-15(21)10-25-17(23)13-9-12-6-4-5-7-14(12)26-18(13)24/h4-7,9,11H,3,8,10H2,1-2H3,(H,19,22)(H,20,21)/t11-/m1/s1 |
| InChIKey | QCWUKHRSOLNKDF-LLVKDONJSA-N |
| XLogP | 0.98 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|