C9H10BrF3N2O2S — CID 65491007
2-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]ethanesulfonamide (PubChem CID 65491007) has the molecular formula C9H10BrF3N2O2S and a molecular weight of 347.16 g/mol. Its IUPAC name is 2-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]ethanesulfonamide.
| Compound Name | 2-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 65491007 |
| Molecular Formula | C9H10BrF3N2O2S |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]ethanesulfonamide |
| SMILES | NCCS(=O)(=O)Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H10BrF3N2O2S/c10-7-3-6(9(11,12)13)4-8(5-7)15-18(16,17)2-1-14/h3-5,15H,1-2,14H2 |
| InChIKey | XYWXQQYIVGZOSN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |