C11H13BrF3NO2S — CID 65490812
3-bromo-N-(1-methylsulfonylpropan-2-yl)-5-(trifluoromethyl)aniline (PubChem CID 65490812) has the molecular formula C11H13BrF3NO2S and a molecular weight of 360.20 g/mol. Its IUPAC name is 3-bromo-N-(1-methylsulfonylpropan-2-yl)-5-(trifluoromethyl)aniline.
| Compound Name | 3-bromo-N-(1-methylsulfonylpropan-2-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 65490812 |
| Molecular Formula | C11H13BrF3NO2S |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 3-bromo-N-(1-methylsulfonylpropan-2-yl)-5-(trifluoromethyl)aniline |
| SMILES | CC(CS(C)(=O)=O)Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13BrF3NO2S/c1-7(6-19(2,17)18)16-10-4-8(11(13,14)15)3-9(12)5-10/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | CHLOMHGPIZIPFP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |