C10H12BrF2NO2S — CID 65467956
4-bromo-2,6-difluoro-N-(1-methylsulfonylpropan-2-yl)aniline (PubChem CID 65467956) has the molecular formula C10H12BrF2NO2S and a molecular weight of 328.18 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(1-methylsulfonylpropan-2-yl)aniline.
| Compound Name | 4-bromo-2,6-difluoro-N-(1-methylsulfonylpropan-2-yl)aniline |
|---|---|
| PubChem CID | 65467956 |
| Molecular Formula | C10H12BrF2NO2S |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(1-methylsulfonylpropan-2-yl)aniline |
| SMILES | CC(CS(C)(=O)=O)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C10H12BrF2NO2S/c1-6(5-17(2,15)16)14-10-8(12)3-7(11)4-9(10)13/h3-4,6,14H,5H2,1-2H3 |
| InChIKey | YAUNKDYCKYPUDF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |