C13H17BrF3N — CID 65489006
3-bromo-N-(2-methylpentan-3-yl)-5-(trifluoromethyl)aniline (PubChem CID 65489006) has the molecular formula C13H17BrF3N and a molecular weight of 324.18 g/mol. Its IUPAC name is 3-bromo-N-(2-methylpentan-3-yl)-5-(trifluoromethyl)aniline.
| Compound Name | 3-bromo-N-(2-methylpentan-3-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 65489006 |
| Molecular Formula | C13H17BrF3N |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3-bromo-N-(2-methylpentan-3-yl)-5-(trifluoromethyl)aniline |
| SMILES | CCC(Nc1cc(Br)cc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C13H17BrF3N/c1-4-12(8(2)3)18-11-6-9(13(15,16)17)5-10(14)7-11/h5-8,12,18H,4H2,1-3H3 |
| InChIKey | KWIOZDAXACBZEN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |