C14H18BrF3N2O — CID 65489625
2-[3-bromo-5-(trifluoromethyl)anilino]-N-tert-butylpropanamide (PubChem CID 65489625) has the molecular formula C14H18BrF3N2O and a molecular weight of 367.21 g/mol. Its IUPAC name is 2-[3-bromo-5-(trifluoromethyl)anilino]-N-tert-butylpropanamide.
| Compound Name | 2-[3-bromo-5-(trifluoromethyl)anilino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 65489625 |
| Molecular Formula | C14H18BrF3N2O |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 2-[3-bromo-5-(trifluoromethyl)anilino]-N-tert-butylpropanamide |
| SMILES | CC(Nc1cc(Br)cc(C(F)(F)F)c1)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H18BrF3N2O/c1-8(12(21)20-13(2,3)4)19-11-6-9(14(16,17)18)5-10(15)7-11/h5-8,19H,1-4H3,(H,20,21) |
| InChIKey | RWPBNVNSFBNZLS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |