C10H12BrF3N2O2S — CID 65491204
3-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]propane-1-sulfonamide (PubChem CID 65491204) has the molecular formula C10H12BrF3N2O2S and a molecular weight of 361.18 g/mol. Its IUPAC name is 3-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]propane-1-sulfonamide.
| Compound Name | 3-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 65491204 |
| Molecular Formula | C10H12BrF3N2O2S |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 359.98 |
| IUPAC Name | 3-amino-N-[3-bromo-5-(trifluoromethyl)phenyl]propane-1-sulfonamide |
| SMILES | NCCCS(=O)(=O)Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H12BrF3N2O2S/c11-8-4-7(10(12,13)14)5-9(6-8)16-19(17,18)3-1-2-15/h4-6,16H,1-3,15H2 |
| InChIKey | VWFBIRIGPYWWOO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |