C11H12F3N3O2S — CID 65484346
3-amino-N-[4-cyano-3-(trifluoromethyl)phenyl]propane-1-sulfonamide (PubChem CID 65484346) has the molecular formula C11H12F3N3O2S and a molecular weight of 307.30 g/mol. Its IUPAC name is 3-amino-N-[4-cyano-3-(trifluoromethyl)phenyl]propane-1-sulfonamide.
| Compound Name | 3-amino-N-[4-cyano-3-(trifluoromethyl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 65484346 |
| Molecular Formula | C11H12F3N3O2S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3-amino-N-[4-cyano-3-(trifluoromethyl)phenyl]propane-1-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)CCCN)cc1C(F)(F)F |
| InChI | InChI=1S/C11H12F3N3O2S/c12-11(13,14)10-6-9(3-2-8(10)7-16)17-20(18,19)5-1-4-15/h2-3,6,17H,1,4-5,15H2 |
| InChIKey | DIRXVFPCVDFXEA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |