C10H9F3N2O4S2 — CID 82834936
N-[4-cyano-3-(trifluoromethyl)phenyl]-1-methylsulfonylmethanesulfonamide (PubChem CID 82834936) has the molecular formula C10H9F3N2O4S2 and a molecular weight of 342.32 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82834936 |
| Molecular Formula | C10H9F3N2O4S2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3N2O4S2/c1-20(16,17)6-21(18,19)15-8-3-2-7(5-14)9(4-8)10(11,12)13/h2-4,15H,6H2,1H3 |
| InChIKey | COVLQZNDIUTGGY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |