C12H13F3N2 — CID 69236124
4-[[(2S)-butan-2-yl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 69236124) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 4-[[(2S)-butan-2-yl]amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[(2S)-butan-2-yl]amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 69236124 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4-[[(2S)-butan-2-yl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC[C@H](C)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2/c1-3-8(2)17-10-5-4-9(7-16)11(6-10)12(13,14)15/h4-6,8,17H,3H2,1-2H3/t8-/m0/s1 |
| InChIKey | PWUVHGJXVZNBHT-QMMMGPOBSA-N |
| XLogP | 3.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |