C12H13F3N2S — CID 113459938
5-(1-methylsulfanylpropan-2-ylamino)-2-(trifluoromethyl)benzonitrile (PubChem CID 113459938) has the molecular formula C12H13F3N2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 5-(1-methylsulfanylpropan-2-ylamino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-(1-methylsulfanylpropan-2-ylamino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 113459938 |
| Molecular Formula | C12H13F3N2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 5-(1-methylsulfanylpropan-2-ylamino)-2-(trifluoromethyl)benzonitrile |
| SMILES | CSCC(C)Nc1ccc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C12H13F3N2S/c1-8(7-18-2)17-10-3-4-11(12(13,14)15)9(5-10)6-16/h3-5,8,17H,7H2,1-2H3 |
| InChIKey | ACLXNFPRKDDLFM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |