C13H15F3N2OS — CID 103820032
4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 103820032) has the molecular formula C13H15F3N2OS and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 103820032 |
| Molecular Formula | C13H15F3N2OS |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | CSC(CO)C(C)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2OS/c1-8(12(7-19)20-2)18-10-4-3-9(6-17)11(5-10)13(14,15)16/h3-5,8,12,18-19H,7H2,1-2H3 |
| InChIKey | IAEZAKMSYCZYGX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |