C18H17F3N2OS — CID 59683303
4-[[(2R)-1-benzylsulfanyl-3-hydroxypropan-2-yl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 59683303) has the molecular formula C18H17F3N2OS and a molecular weight of 366.41 g/mol. Its IUPAC name is 4-[[(2R)-1-benzylsulfanyl-3-hydroxypropan-2-yl]amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[(2R)-1-benzylsulfanyl-3-hydroxypropan-2-yl]amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 59683303 |
| Molecular Formula | C18H17F3N2OS |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[[(2R)-1-benzylsulfanyl-3-hydroxypropan-2-yl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N[C@H](CO)CSCc2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2OS/c19-18(20,21)17-8-15(7-6-14(17)9-22)23-16(10-24)12-25-11-13-4-2-1-3-5-13/h1-8,16,23-24H,10-12H2/t16-/m1/s1 |
| InChIKey | JLROUUYTZWXWKP-MRXNPFEDSA-N |
| XLogP | 4.28 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |