C16H15F3N2O3 — CID 11279236
(2S)-2-[4-nitro-3-(trifluoromethyl)anilino]-3-phenylpropan-1-ol (PubChem CID 11279236) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is (2S)-2-[4-nitro-3-(trifluoromethyl)anilino]-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-[4-nitro-3-(trifluoromethyl)anilino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11279236 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (2S)-2-[4-nitro-3-(trifluoromethyl)anilino]-3-phenylpropan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H](CO)Cc2ccccc2)cc1C(F)(F)F |
| InChI | InChI=1S/C16H15F3N2O3/c17-16(18,19)14-9-12(6-7-15(14)21(23)24)20-13(10-22)8-11-4-2-1-3-5-11/h1-7,9,13,20,22H,8,10H2/t13-/m0/s1 |
| InChIKey | SVBXROJVBZZSLB-ZDUSSCGKSA-N |
| XLogP | 3.63 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|